C10H17NO5S — CID 87968447
(2,5-dioxopyrrolidin-3-yl) hexane-1-sulfonate (PubChem CID 87968447) has the molecular formula C10H17NO5S and a molecular weight of 263.31 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-3-yl) hexane-1-sulfonate.
| Compound Name | (2,5-dioxopyrrolidin-3-yl) hexane-1-sulfonate |
|---|---|
| PubChem CID | 87968447 |
| Molecular Formula | C10H17NO5S |
| Molecular Weight | 263.31 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | (2,5-dioxopyrrolidin-3-yl) hexane-1-sulfonate |
| SMILES | CCCCCCS(=O)(=O)OC1CC(=O)NC1=O |
| InChI | InChI=1S/C10H17NO5S/c1-2-3-4-5-6-17(14,15)16-8-7-9(12)11-10(8)13/h8H,2-7H2,1H3,(H,11,12,13) |
| InChIKey | GEOIRLJKLVEIGS-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.31 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|