C16H18N2O6S2 — CID 87974873
(3-methylphenyl) 2-(ethylsulfonylcarbamoylamino)benzenesulfonate (PubChem CID 87974873) has the molecular formula C16H18N2O6S2 and a molecular weight of 398.46 g/mol. Its IUPAC name is (3-methylphenyl) 2-(ethylsulfonylcarbamoylamino)benzenesulfonate.
| Compound Name | (3-methylphenyl) 2-(ethylsulfonylcarbamoylamino)benzenesulfonate |
|---|---|
| PubChem CID | 87974873 |
| Molecular Formula | C16H18N2O6S2 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.06 |
| IUPAC Name | (3-methylphenyl) 2-(ethylsulfonylcarbamoylamino)benzenesulfonate |
| SMILES | CCS(=O)(=O)NC(=O)Nc1ccccc1S(=O)(=O)Oc1cccc(C)c1 |
| InChI | InChI=1S/C16H18N2O6S2/c1-3-25(20,21)18-16(19)17-14-9-4-5-10-15(14)26(22,23)24-13-8-6-7-12(2)11-13/h4-11H,3H2,1-2H3,(H2,17,18,19) |
| InChIKey | ZIMHWGJWHUAMSY-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|