C32H48O5 — CID 87978997
(1S,2R,7R,12S)-1,2,5,12-tetramethyl-8-oxatricyclo[7.2.1.02,7]dodec-9-ene;[(1S,2R,7R,9R)-1,2,5-trimethylspiro[8-oxatricyclo[7.2.1.02,7]dodec-5-ene-12,2'-oxirane]-11-yl] acetate (PubChem CID 87978997) has the molecular formula C32H48O5 and a molecular weight of 512.73 g/mol. Its IUPAC name is (1S,2R,7R,12S)-1,2,5,12-tetramethyl-8-oxatricyclo[7.2.1.02,7]dodec-9-ene;[(1S,2R,7R,9R)-1,2,5-trimethylspiro[8-oxatricyclo[7.2.1.02,7]dodec-5-ene-12,2'-oxirane]-11-yl] acetate.
| Compound Name | (1S,2R,7R,12S)-1,2,5,12-tetramethyl-8-oxatricyclo[7.2.1.02,7]dodec-9-ene;[(1S,2R,7R,9R)-1,2,5-trimethylspiro[8-oxatricyclo[7.2.1.02,7]dodec-5-ene-12,2'-oxirane]-11-yl] acetate |
|---|---|
| PubChem CID | 87978997 |
| Molecular Formula | C32H48O5 |
| Molecular Weight | 512.73 g/mol |
| Exact Mass | 512.35 |
| IUPAC Name | (1S,2R,7R,12S)-1,2,5,12-tetramethyl-8-oxatricyclo[7.2.1.02,7]dodec-9-ene;[(1S,2R,7R,9R)-1,2,5-trimethylspiro[8-oxatricyclo[7.2.1.02,7]dodec-5-ene-12,2'-oxirane]-11-yl] acetate |
| SMILES | CC(=O)OC1C[C@H]2O[C@@H]3C=C(C)CC[C@]3(C)[C@]1(C)C21CO1.CC1CC[C@@]2(C)[C@@H](C1)OC1=CC[C@@]2(C)[C@@H]1C |
| InChI | InChI=1S/C17H24O4.C15H24O/c1-10-5-6-15(3)12(7-10)21-14-8-13(20-11(2)18)16(15,4)17(14)9-19-17;1-10-5-7-15(4)13(9-10)16-12-6-8-14(15,3)11(12)2/h7,12-14H,5-6,8-9H2,1-4H3;6,10-11,13H,5,7-9H2,1-4H3/t12-,13?,14-,15+,16-,17?;10?,11-,13-,14+,15+/m11/s1 |
| InChIKey | UGECOAYETXTYFS-HINIJUJKSA-N |
| XLogP | 6.75 |
| TPSA | 57.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.73 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|