C27H53N7O8 — CID 87982278
3-hydroxypropyl 2-[3-[2,6-bis(2,6-diaminohexanoylamino)hexanoylamino]propanoyloxy]propanoate (PubChem CID 87982278) has the molecular formula C27H53N7O8 and a molecular weight of 603.76 g/mol. Its IUPAC name is 3-hydroxypropyl 2-[3-[2,6-bis(2,6-diaminohexanoylamino)hexanoylamino]propanoyloxy]propanoate.
| Compound Name | 3-hydroxypropyl 2-[3-[2,6-bis(2,6-diaminohexanoylamino)hexanoylamino]propanoyloxy]propanoate |
|---|---|
| PubChem CID | 87982278 |
| Molecular Formula | C27H53N7O8 |
| Molecular Weight | 603.76 g/mol |
| Exact Mass | 603.40 |
| IUPAC Name | 3-hydroxypropyl 2-[3-[2,6-bis(2,6-diaminohexanoylamino)hexanoylamino]propanoyloxy]propanoate |
| SMILES | CC(OC(=O)CCNC(=O)C(CCCCNC(=O)C(N)CCCCN)NC(=O)C(N)CCCCN)C(=O)OCCCO |
| InChI | InChI=1S/C27H53N7O8/c1-19(27(40)41-18-8-17-35)42-23(36)12-16-33-26(39)22(34-25(38)21(31)10-3-6-14-29)11-4-7-15-32-24(37)20(30)9-2-5-13-28/h19-22,35H,2-18,28-31H2,1H3,(H,32,37)(H,33,39)(H,34,38) |
| InChIKey | DLDSEITYVZKPGF-UHFFFAOYSA-N |
| XLogP | -1.97 |
| TPSA | 264.21 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.76 |
| LogP ≤ 5 | -1.97 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|