C18H24Cl2 — CID 87982584
1-chloro-5-[2-(2-chloro-3,4,5-trimethylcyclopenta-2,4-dien-1-yl)ethyl]-2,3,4-trimethylcyclopenta-1,3-diene (PubChem CID 87982584) has the molecular formula C18H24Cl2 and a molecular weight of 311.30 g/mol. Its IUPAC name is 1-chloro-5-[2-(2-chloro-3,4,5-trimethylcyclopenta-2,4-dien-1-yl)ethyl]-2,3,4-trimethylcyclopenta-1,3-diene.
| Compound Name | 1-chloro-5-[2-(2-chloro-3,4,5-trimethylcyclopenta-2,4-dien-1-yl)ethyl]-2,3,4-trimethylcyclopenta-1,3-diene |
|---|---|
| PubChem CID | 87982584 |
| Molecular Formula | C18H24Cl2 |
| Molecular Weight | 311.30 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | 1-chloro-5-[2-(2-chloro-3,4,5-trimethylcyclopenta-2,4-dien-1-yl)ethyl]-2,3,4-trimethylcyclopenta-1,3-diene |
| SMILES | CC1=C(C)C(CCC2C(C)=C(C)C(C)=C2Cl)C(Cl)=C1C |
| InChI | InChI=1S/C18H24Cl2/c1-9-11(3)15(17(19)13(9)5)7-8-16-12(4)10(2)14(6)18(16)20/h15-16H,7-8H2,1-6H3 |
| InChIKey | MQOJXTYLHVRECA-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.30 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |