C32H42F3N7O3 — CID 87983576
3-(4-carbamimidoylphenyl)-N-[(1S)-2-[(1-carbamimidoylpiperidin-4-yl)methylamino]-1-cyclohexyl-2-oxoethyl]-2-[2-(trifluoromethoxy)phenyl]propanamide (PubChem CID 87983576) has the molecular formula C32H42F3N7O3 and a molecular weight of 629.73 g/mol. Its IUPAC name is 3-(4-carbamimidoylphenyl)-N-[(1S)-2-[(1-carbamimidoylpiperidin-4-yl)methylamino]-1-cyclohexyl-2-oxoethyl]-2-[2-(trifluoromethoxy)phenyl]propanamide.
| Compound Name | 3-(4-carbamimidoylphenyl)-N-[(1S)-2-[(1-carbamimidoylpiperidin-4-yl)methylamino]-1-cyclohexyl-2-oxoethyl]-2-[2-(trifluoromethoxy)phenyl]propanamide |
|---|---|
| PubChem CID | 87983576 |
| Molecular Formula | C32H42F3N7O3 |
| Molecular Weight | 629.73 g/mol |
| Exact Mass | 629.33 |
| IUPAC Name | 3-(4-carbamimidoylphenyl)-N-[(1S)-2-[(1-carbamimidoylpiperidin-4-yl)methylamino]-1-cyclohexyl-2-oxoethyl]-2-[2-(trifluoromethoxy)phenyl]propanamide |
| SMILES | [H]/N=C(\N)c1ccc(CC(C(=O)N[C@H](C(=O)NCC2CCN(/C(N)=N/[H])CC2)C2CCCCC2)c2ccccc2OC(F)(F)F)cc1 |
| InChI | InChI=1S/C32H42F3N7O3/c33-32(34,35)45-26-9-5-4-8-24(26)25(18-20-10-12-23(13-11-20)28(36)37)29(43)41-27(22-6-2-1-3-7-22)30(44)40-19-21-14-16-42(17-15-21)31(38)39/h4-5,8-13,21-22,25,27H,1-3,6-7,14-19H2,(H3,36,37)(H3,38,39)(H,40,44)(H,41,43)/t25?,27-/m0/s1 |
| InChIKey | UJQLCXFGKJIFII-GPNIZQGCSA-N |
| XLogP | 3.98 |
| TPSA | 170.41 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.73 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|