C21H25F3N2O5 — CID 87985480
benzyl 4-[(1R,2R)-2-(2,2,2-trifluoroacetyl)oxycarbonylcyclohexyl]piperazine-1-carboxylate (PubChem CID 87985480) has the molecular formula C21H25F3N2O5 and a molecular weight of 442.43 g/mol. Its IUPAC name is benzyl 4-[(1R,2R)-2-(2,2,2-trifluoroacetyl)oxycarbonylcyclohexyl]piperazine-1-carboxylate.
| Compound Name | benzyl 4-[(1R,2R)-2-(2,2,2-trifluoroacetyl)oxycarbonylcyclohexyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 87985480 |
| Molecular Formula | C21H25F3N2O5 |
| Molecular Weight | 442.43 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | benzyl 4-[(1R,2R)-2-(2,2,2-trifluoroacetyl)oxycarbonylcyclohexyl]piperazine-1-carboxylate |
| SMILES | O=C(OC(=O)C(F)(F)F)[C@@H]1CCCC[C@H]1N1CCN(C(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C21H25F3N2O5/c22-21(23,24)19(28)31-18(27)16-8-4-5-9-17(16)25-10-12-26(13-11-25)20(29)30-14-15-6-2-1-3-7-15/h1-3,6-7,16-17H,4-5,8-14H2/t16-,17-/m1/s1 |
| InChIKey | PFVJSWIVPRMUOH-IAGOWNOFSA-N |
| XLogP | 3.13 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.43 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|