C30H41N3O3S2 — CID 87985839
N-[5-(4-methylsulfonylphenyl)-4-[4-[3-(2,2,4,4-tetramethylpentan-3-ylamino)propyl]phenyl]-1,3-thiazol-2-yl]acetamide (PubChem CID 87985839) has the molecular formula C30H41N3O3S2 and a molecular weight of 555.81 g/mol. Its IUPAC name is N-[5-(4-methylsulfonylphenyl)-4-[4-[3-(2,2,4,4-tetramethylpentan-3-ylamino)propyl]phenyl]-1,3-thiazol-2-yl]acetamide.
| Compound Name | N-[5-(4-methylsulfonylphenyl)-4-[4-[3-(2,2,4,4-tetramethylpentan-3-ylamino)propyl]phenyl]-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 87985839 |
| Molecular Formula | C30H41N3O3S2 |
| Molecular Weight | 555.81 g/mol |
| Exact Mass | 555.26 |
| IUPAC Name | N-[5-(4-methylsulfonylphenyl)-4-[4-[3-(2,2,4,4-tetramethylpentan-3-ylamino)propyl]phenyl]-1,3-thiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1nc(-c2ccc(CCCNC(C(C)(C)C)C(C)(C)C)cc2)c(-c2ccc(S(C)(=O)=O)cc2)s1 |
| InChI | InChI=1S/C30H41N3O3S2/c1-20(34)32-28-33-25(26(37-28)23-15-17-24(18-16-23)38(8,35)36)22-13-11-21(12-14-22)10-9-19-31-27(29(2,3)4)30(5,6)7/h11-18,27,31H,9-10,19H2,1-8H3,(H,32,33,34) |
| InChIKey | QYQUVPJIYAPITG-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.81 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|