C19H22O19 — CID 87990470
butanedioic acid;(E)-but-2-enedioic acid;1-(4-carboxy-2-oxobutanoyl)oxypropane-1,2,3-tricarboxylic acid (PubChem CID 87990470) has the molecular formula C19H22O19 and a molecular weight of 554.37 g/mol. Its IUPAC name is butanedioic acid;(E)-but-2-enedioic acid;1-(4-carboxy-2-oxobutanoyl)oxypropane-1,2,3-tricarboxylic acid.
| Compound Name | butanedioic acid;(E)-but-2-enedioic acid;1-(4-carboxy-2-oxobutanoyl)oxypropane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 87990470 |
| Molecular Formula | C19H22O19 |
| Molecular Weight | 554.37 g/mol |
| Exact Mass | 554.08 |
| IUPAC Name | butanedioic acid;(E)-but-2-enedioic acid;1-(4-carboxy-2-oxobutanoyl)oxypropane-1,2,3-tricarboxylic acid |
| SMILES | O=C(O)/C=C/C(=O)O.O=C(O)CCC(=O)C(=O)OC(C(=O)O)C(CC(=O)O)C(=O)O.O=C(O)CCC(=O)O |
| InChI | InChI=1S/C11H12O11.C4H6O4.C4H4O4/c12-5(1-2-6(13)14)11(21)22-8(10(19)20)4(9(17)18)3-7(15)16;2*5-3(6)1-2-4(7)8/h4,8H,1-3H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20);1-2H2,(H,5,6)(H,7,8);1-2H,(H,5,6)(H,7,8)/b;;2-1+ |
| InChIKey | KGJKQFJATUYOAW-WXXKFALUSA-N |
| XLogP | -1.76 |
| TPSA | 341.77 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.37 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|