C24H31N3O3S — CID 87993526
(5-methyl-2-propan-2-ylcyclohexyl) N-[2-(1-benzothiophen-3-yl)-3-(cyanomethylamino)-3-oxopropyl]carbamate (PubChem CID 87993526) has the molecular formula C24H31N3O3S and a molecular weight of 441.60 g/mol. Its IUPAC name is (5-methyl-2-propan-2-ylcyclohexyl) N-[2-(1-benzothiophen-3-yl)-3-(cyanomethylamino)-3-oxopropyl]carbamate.
| Compound Name | (5-methyl-2-propan-2-ylcyclohexyl) N-[2-(1-benzothiophen-3-yl)-3-(cyanomethylamino)-3-oxopropyl]carbamate |
|---|---|
| PubChem CID | 87993526 |
| Molecular Formula | C24H31N3O3S |
| Molecular Weight | 441.60 g/mol |
| Exact Mass | 441.21 |
| IUPAC Name | (5-methyl-2-propan-2-ylcyclohexyl) N-[2-(1-benzothiophen-3-yl)-3-(cyanomethylamino)-3-oxopropyl]carbamate |
| SMILES | CC1CCC(C(C)C)C(OC(=O)NCC(C(=O)NCC#N)c2csc3ccccc23)C1 |
| InChI | InChI=1S/C24H31N3O3S/c1-15(2)17-9-8-16(3)12-21(17)30-24(29)27-13-19(23(28)26-11-10-25)20-14-31-22-7-5-4-6-18(20)22/h4-7,14-17,19,21H,8-9,11-13H2,1-3H3,(H,26,28)(H,27,29) |
| InChIKey | JOLUNCOFTUMVRF-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.60 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|