C22H31N3O4 — CID 87993550
(5-methyl-2-propan-2-ylcyclohexyl) N-[3-(cyanomethylamino)-2-(4-hydroxyphenyl)-3-oxopropyl]carbamate (PubChem CID 87993550) has the molecular formula C22H31N3O4 and a molecular weight of 401.51 g/mol. Its IUPAC name is (5-methyl-2-propan-2-ylcyclohexyl) N-[3-(cyanomethylamino)-2-(4-hydroxyphenyl)-3-oxopropyl]carbamate.
| Compound Name | (5-methyl-2-propan-2-ylcyclohexyl) N-[3-(cyanomethylamino)-2-(4-hydroxyphenyl)-3-oxopropyl]carbamate |
|---|---|
| PubChem CID | 87993550 |
| Molecular Formula | C22H31N3O4 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.23 |
| IUPAC Name | (5-methyl-2-propan-2-ylcyclohexyl) N-[3-(cyanomethylamino)-2-(4-hydroxyphenyl)-3-oxopropyl]carbamate |
| SMILES | CC1CCC(C(C)C)C(OC(=O)NCC(C(=O)NCC#N)c2ccc(O)cc2)C1 |
| InChI | InChI=1S/C22H31N3O4/c1-14(2)18-9-4-15(3)12-20(18)29-22(28)25-13-19(21(27)24-11-10-23)16-5-7-17(26)8-6-16/h5-8,14-15,18-20,26H,4,9,11-13H2,1-3H3,(H,24,27)(H,25,28) |
| InChIKey | DTRFASXVKQNPQS-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 111.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|