C18H18Cl2N2O3S — CID 8799498
[(E)-[amino-(3-methoxyphenyl)methylidene]amino] 3-[(3,4-dichlorophenyl)methylsulfanyl]propanoate (PubChem CID 8799498) has the molecular formula C18H18Cl2N2O3S and a molecular weight of 413.33 g/mol. Its IUPAC name is [(E)-[amino-(3-methoxyphenyl)methylidene]amino] 3-[(3,4-dichlorophenyl)methylsulfanyl]propanoate.
| Compound Name | [(E)-[amino-(3-methoxyphenyl)methylidene]amino] 3-[(3,4-dichlorophenyl)methylsulfanyl]propanoate |
|---|---|
| PubChem CID | 8799498 |
| Molecular Formula | C18H18Cl2N2O3S |
| Molecular Weight | 413.33 g/mol |
| Exact Mass | 412.04 |
| IUPAC Name | [(E)-[amino-(3-methoxyphenyl)methylidene]amino] 3-[(3,4-dichlorophenyl)methylsulfanyl]propanoate |
| SMILES | COc1cccc(/C(N)=N\OC(=O)CCSCc2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C18H18Cl2N2O3S/c1-24-14-4-2-3-13(10-14)18(21)22-25-17(23)7-8-26-11-12-5-6-15(19)16(20)9-12/h2-6,9-10H,7-8,11H2,1H3,(H2,21,22) |
| InChIKey | HAYQQMNHWQYLMD-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.33 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|