C20H38O10 — CID 87997473
bis[2,2-di(propan-2-yloxy)ethyl] 2,3-dihydroxybutanedioate (PubChem CID 87997473) has the molecular formula C20H38O10 and a molecular weight of 438.51 g/mol. Its IUPAC name is bis[2,2-di(propan-2-yloxy)ethyl] 2,3-dihydroxybutanedioate.
| Compound Name | bis[2,2-di(propan-2-yloxy)ethyl] 2,3-dihydroxybutanedioate |
|---|---|
| PubChem CID | 87997473 |
| Molecular Formula | C20H38O10 |
| Molecular Weight | 438.51 g/mol |
| Exact Mass | 438.25 |
| IUPAC Name | bis[2,2-di(propan-2-yloxy)ethyl] 2,3-dihydroxybutanedioate |
| SMILES | CC(C)OC(COC(=O)C(O)C(O)C(=O)OCC(OC(C)C)OC(C)C)OC(C)C |
| InChI | InChI=1S/C20H38O10/c1-11(2)27-15(28-12(3)4)9-25-19(23)17(21)18(22)20(24)26-10-16(29-13(5)6)30-14(7)8/h11-18,21-22H,9-10H2,1-8H3 |
| InChIKey | FUYKRMQTUHJFBA-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 129.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.51 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|