C31H30Cl2OSiZr-2 — CID 87998033
dichloro(dimethylsilylidene)zirconium;9H-fluoren-9-ide;3-(9H-fluoren-9-id-1-yl)propan-1-ol (PubChem CID 87998033) has the molecular formula C31H30Cl2OSiZr-2 and a molecular weight of 608.80 g/mol. Its IUPAC name is dichloro(dimethylsilylidene)zirconium;9H-fluoren-9-ide;3-(9H-fluoren-9-id-1-yl)propan-1-ol.
| Compound Name | dichloro(dimethylsilylidene)zirconium;9H-fluoren-9-ide;3-(9H-fluoren-9-id-1-yl)propan-1-ol |
|---|---|
| PubChem CID | 87998033 |
| Molecular Formula | C31H30Cl2OSiZr-2 |
| Molecular Weight | 608.80 g/mol |
| Exact Mass | 606.05 |
| IUPAC Name | dichloro(dimethylsilylidene)zirconium;9H-fluoren-9-ide;3-(9H-fluoren-9-id-1-yl)propan-1-ol |
| SMILES | C[Si](C)=[Zr](Cl)Cl.OCCCc1cccc2c1[cH-]c1ccccc12.c1ccc2c(c1)[cH-]c1ccccc12 |
| InChI | InChI=1S/C16H15O.C13H9.C2H6Si.2ClH.Zr/c17-10-4-7-12-6-3-9-15-14-8-2-1-5-13(14)11-16(12)15;1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;1-3-2;;;/h1-3,5-6,8-9,11,17H,4,7,10H2;1-9H;1-2H3;2*1H;/q2*-1;;;;+2/p-2 |
| InChIKey | URFSBHDUXNOBLC-UHFFFAOYSA-L |
| XLogP | 9.51 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.80 |
| LogP ≤ 5 | 9.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|