C18H17N7OS2 — CID 8811592
N'-[(E)-2-cyano-2-(4-methyl-1,3-thiazol-2-yl)ethenyl]-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]benzohydrazide (PubChem CID 8811592) has the molecular formula C18H17N7OS2 and a molecular weight of 411.52 g/mol. Its IUPAC name is N'-[(E)-2-cyano-2-(4-methyl-1,3-thiazol-2-yl)ethenyl]-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]benzohydrazide.
| Compound Name | N'-[(E)-2-cyano-2-(4-methyl-1,3-thiazol-2-yl)ethenyl]-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]benzohydrazide |
|---|---|
| PubChem CID | 8811592 |
| Molecular Formula | C18H17N7OS2 |
| Molecular Weight | 411.52 g/mol |
| Exact Mass | 411.09 |
| IUPAC Name | N'-[(E)-2-cyano-2-(4-methyl-1,3-thiazol-2-yl)ethenyl]-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]benzohydrazide |
| SMILES | Cc1csc(/C(C#N)=C/NNC(=O)c2ccc(CSc3nncn3C)cc2)n1 |
| InChI | InChI=1S/C18H17N7OS2/c1-12-9-27-17(22-12)15(7-19)8-20-23-16(26)14-5-3-13(4-6-14)10-28-18-24-21-11-25(18)2/h3-6,8-9,11,20H,10H2,1-2H3,(H,23,26)/b15-8+ |
| InChIKey | MBRGCRDSOQAZJU-OVCLIPMQSA-N |
| XLogP | 2.67 |
| TPSA | 108.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.52 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|