C18H16ClFN4O3 — CID 8833290
5-[[5-chloro-1-[(4-fluorophenyl)methyl]-3-methylpyrazol-4-yl]methylidene]-1,3-dimethyl-1,3-diazinane-2,4,6-trione (PubChem CID 8833290) has the molecular formula C18H16ClFN4O3 and a molecular weight of 390.80 g/mol. Its IUPAC name is 5-[[5-chloro-1-[(4-fluorophenyl)methyl]-3-methylpyrazol-4-yl]methylidene]-1,3-dimethyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[[5-chloro-1-[(4-fluorophenyl)methyl]-3-methylpyrazol-4-yl]methylidene]-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 8833290 |
| Molecular Formula | C18H16ClFN4O3 |
| Molecular Weight | 390.80 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | 5-[[5-chloro-1-[(4-fluorophenyl)methyl]-3-methylpyrazol-4-yl]methylidene]-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
| SMILES | Cc1nn(Cc2ccc(F)cc2)c(Cl)c1C=C1C(=O)N(C)C(=O)N(C)C1=O |
| InChI | InChI=1S/C18H16ClFN4O3/c1-10-13(8-14-16(25)22(2)18(27)23(3)17(14)26)15(19)24(21-10)9-11-4-6-12(20)7-5-11/h4-8H,9H2,1-3H3 |
| InChIKey | JBHZWIGPBAUANX-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 75.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.80 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|