About 2-(sulfonylamino)ethyl prop-2-enoate
2-(sulfonylamino)ethyl prop-2-enoate (PubChem CID 88503006) has the molecular formula C5H7NO4S
and a molecular weight of 177.18 g/mol. Its IUPAC name is 2-(sulfonylamino)ethyl prop-2-enoate.
Molecular Properties
| Compound Name | 2-(sulfonylamino)ethyl prop-2-enoate |
| PubChem CID | 88503006 |
| Molecular Formula | C5H7NO4S |
| Molecular Weight | 177.18 g/mol |
| Exact Mass | 177.01 |
| IUPAC Name | 2-(sulfonylamino)ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCN=S(=O)=O |
| InChI | InChI=1S/C5H7NO4S/c1-2-5(7)10-4-3-6-11(8)9/h2H,1,3-4H2 |
| InChIKey | SSHAQAUMTREYJB-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 72.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.18 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(sulfonylamino)ethyl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(sulfonylamino)ethyl prop-2-enoate?
The IUPAC name of 2-(sulfonylamino)ethyl prop-2-enoate (CID 88503006) is 2-(sulfonylamino)ethyl prop-2-enoate.
What is the SMILES notation for 2-(sulfonylamino)ethyl prop-2-enoate?
The canonical SMILES for 2-(sulfonylamino)ethyl prop-2-enoate is C=CC(=O)OCCN=S(=O)=O.
What is the InChIKey of 2-(sulfonylamino)ethyl prop-2-enoate?
The InChIKey is SSHAQAUMTREYJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7NO4S/c1-2-5(7)10-4-3-6-11(8)9/h2H,1,3-4H2.
What are the key properties of 2-(sulfonylamino)ethyl prop-2-enoate?
2-(sulfonylamino)ethyl prop-2-enoate has a molecular weight of 177.18 g/mol, XLogP of -0.22, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(sulfonylamino)ethyl prop-2-enoate is sourced from PubChem (CID 88503006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).