C27H35N8O+ — CID 88503469
2-[1-methyl-8-pentyl-7-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-3,6-dihydro-2H-purin-1-ium-1-yl]ethanol (PubChem CID 88503469) has the molecular formula C27H35N8O+ and a molecular weight of 487.63 g/mol. Its IUPAC name is 2-[1-methyl-8-pentyl-7-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-3,6-dihydro-2H-purin-1-ium-1-yl]ethanol.
| Compound Name | 2-[1-methyl-8-pentyl-7-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-3,6-dihydro-2H-purin-1-ium-1-yl]ethanol |
|---|---|
| PubChem CID | 88503469 |
| Molecular Formula | C27H35N8O+ |
| Molecular Weight | 487.63 g/mol |
| Exact Mass | 487.29 |
| IUPAC Name | 2-[1-methyl-8-pentyl-7-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-3,6-dihydro-2H-purin-1-ium-1-yl]ethanol |
| SMILES | CCCCCc1nc2c(n1Cc1ccc(-c3ccccc3-c3nn[nH]n3)cc1)C[N+](C)(CCO)CN2 |
| InChI | InChI=1S/C27H35N8O/c1-3-4-5-10-25-29-27-24(18-35(2,15-16-36)19-28-27)34(25)17-20-11-13-21(14-12-20)22-8-6-7-9-23(22)26-30-32-33-31-26/h6-9,11-14,28,36H,3-5,10,15-19H2,1-2H3,(H,30,31,32,33)/q+1 |
| InChIKey | AOULEFARIGDJEO-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 104.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.63 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|