C34H38N8 — CID 67911867
1-(cyclopropylmethyl)-8-pentyl-3-phenyl-7-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-2,6-dihydropurine (PubChem CID 67911867) has the molecular formula C34H38N8 and a molecular weight of 558.73 g/mol. Its IUPAC name is 1-(cyclopropylmethyl)-8-pentyl-3-phenyl-7-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-2,6-dihydropurine.
| Compound Name | 1-(cyclopropylmethyl)-8-pentyl-3-phenyl-7-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-2,6-dihydropurine |
|---|---|
| PubChem CID | 67911867 |
| Molecular Formula | C34H38N8 |
| Molecular Weight | 558.73 g/mol |
| Exact Mass | 558.32 |
| IUPAC Name | 1-(cyclopropylmethyl)-8-pentyl-3-phenyl-7-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-2,6-dihydropurine |
| SMILES | CCCCCc1nc2c(n1Cc1ccc(-c3ccccc3-c3nn[nH]n3)cc1)CN(CC1CC1)CN2c1ccccc1 |
| InChI | InChI=1S/C34H38N8/c1-2-3-5-14-32-35-34-31(23-40(21-25-15-16-25)24-42(34)28-10-6-4-7-11-28)41(32)22-26-17-19-27(20-18-26)29-12-8-9-13-30(29)33-36-38-39-37-33/h4,6-13,17-20,25H,2-3,5,14-16,21-24H2,1H3,(H,36,37,38,39) |
| InChIKey | NHWADSHERHZXJK-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.73 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|