C86H156N2O10 — CID 88505323
(3S)-3-[bis[(Z)-octadec-9-enyl]amino]-4-[6-[(2S)-2-[bis[(Z)-octadec-9-enyl]amino]-3-carboxypropanoyl]oxy-6-oxohexanoyl]oxy-4-oxobutanoic acid (PubChem CID 88505323) has the molecular formula C86H156N2O10 and a molecular weight of 1378.20 g/mol. Its IUPAC name is (3S)-3-[bis[(Z)-octadec-9-enyl]amino]-4-[6-[(2S)-2-[bis[(Z)-octadec-9-enyl]amino]-3-carboxypropanoyl]oxy-6-oxohexanoyl]oxy-4-oxobutanoic acid.
| Compound Name | (3S)-3-[bis[(Z)-octadec-9-enyl]amino]-4-[6-[(2S)-2-[bis[(Z)-octadec-9-enyl]amino]-3-carboxypropanoyl]oxy-6-oxohexanoyl]oxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 88505323 |
| Molecular Formula | C86H156N2O10 |
| Molecular Weight | 1378.20 g/mol |
| Exact Mass | 1377.18 |
| IUPAC Name | (3S)-3-[bis[(Z)-octadec-9-enyl]amino]-4-[6-[(2S)-2-[bis[(Z)-octadec-9-enyl]amino]-3-carboxypropanoyl]oxy-6-oxohexanoyl]oxy-4-oxobutanoic acid |
| SMILES | CCCCCCCC/C=C\CCCCCCCCN(CCCCCCCC/C=C\CCCCCCCC)[C@@H](CC(=O)O)C(=O)OC(=O)CCCCC(=O)OC(=O)[C@H](CC(=O)O)N(CCCCCCCC/C=C\CCCCCCCC)CCCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C86H156N2O10/c1-5-9-13-17-21-25-29-33-37-41-45-49-53-57-61-67-73-87(74-68-62-58-54-50-46-42-38-34-30-26-22-18-14-10-6-2)79(77-81(89)90)85(95)97-83(93)71-65-66-72-84(94)98-86(96)80(78-82(91)92)88(75-69-63-59-55-51-47-43-39-35-31-27-23-19-15-11-7-3)76-70-64-60-56-52-48-44-40-36-32-28-24-20-16-12-8-4/h33-40,79-80H,5-32,41-78H2,1-4H3,(H,89,90)(H,91,92)/b37-33-,38-34-,39-35-,40-36-/t79-,80-/m0/s1 |
| InChIKey | JNXHMUUQXFFDLC-XCVVOBKTSA-N |
| XLogP | 25.13 |
| TPSA | 167.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 77 |
| Heavy Atoms | 98 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1378.20 |
| LogP ≤ 5 | 25.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|