C11H18O7S3 — CID 88509977
2-[1,1-bis(carboxymethylsulfanyl)-3-hydroxy-2-methylbutyl]sulfanylacetic acid (PubChem CID 88509977) has the molecular formula C11H18O7S3 and a molecular weight of 358.46 g/mol. Its IUPAC name is 2-[1,1-bis(carboxymethylsulfanyl)-3-hydroxy-2-methylbutyl]sulfanylacetic acid.
| Compound Name | 2-[1,1-bis(carboxymethylsulfanyl)-3-hydroxy-2-methylbutyl]sulfanylacetic acid |
|---|---|
| PubChem CID | 88509977 |
| Molecular Formula | C11H18O7S3 |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.02 |
| IUPAC Name | 2-[1,1-bis(carboxymethylsulfanyl)-3-hydroxy-2-methylbutyl]sulfanylacetic acid |
| SMILES | CC(O)C(C)C(SCC(=O)O)(SCC(=O)O)SCC(=O)O |
| InChI | InChI=1S/C11H18O7S3/c1-6(7(2)12)11(19-3-8(13)14,20-4-9(15)16)21-5-10(17)18/h6-7,12H,3-5H2,1-2H3,(H,13,14)(H,15,16)(H,17,18) |
| InChIKey | YNMGZVUZJAWVMY-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|