About 4-(dimethylamino)-2-methylbenzenediazonium;zinc;chloride
4-(dimethylamino)-2-methylbenzenediazonium;zinc;chloride (PubChem CID 88518290) has the molecular formula C9H12ClN3Zn
and a molecular weight of 263.06 g/mol. Its IUPAC name is 4-(dimethylamino)-2-methylbenzenediazonium;zinc;chloride.
Molecular Properties
| Compound Name | 4-(dimethylamino)-2-methylbenzenediazonium;zinc;chloride |
| PubChem CID | 88518290 |
| Molecular Formula | C9H12ClN3Zn |
| Molecular Weight | 263.06 g/mol |
| Exact Mass | 261.00 |
| IUPAC Name | 4-(dimethylamino)-2-methylbenzenediazonium;zinc;chloride |
| SMILES | Cc1cc(N(C)C)ccc1[N+]#N.[Cl-].[Zn] |
| InChI | InChI=1S/C9H12N3.ClH.Zn/c1-7-6-8(12(2)3)4-5-9(7)11-10;;/h4-6H,1-3H3;1H;/q+1;;/p-1 |
| InChIKey | AUHQFTLEDHKNSI-UHFFFAOYSA-M |
| XLogP | -0.45 |
| TPSA | 31.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.06 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4-(dimethylamino)-2-methylbenzenediazonium;zinc;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(dimethylamino)-2-methylbenzenediazonium;zinc;chloride?
The IUPAC name of 4-(dimethylamino)-2-methylbenzenediazonium;zinc;chloride (CID 88518290) is 4-(dimethylamino)-2-methylbenzenediazonium;zinc;chloride.
What is the SMILES notation for 4-(dimethylamino)-2-methylbenzenediazonium;zinc;chloride?
The canonical SMILES for 4-(dimethylamino)-2-methylbenzenediazonium;zinc;chloride is Cc1cc(N(C)C)ccc1[N+]#N.[Cl-].[Zn].
What is the InChIKey of 4-(dimethylamino)-2-methylbenzenediazonium;zinc;chloride?
The InChIKey is AUHQFTLEDHKNSI-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H12N3.ClH.Zn/c1-7-6-8(12(2)3)4-5-9(7)11-10;;/h4-6H,1-3H3;1H;/q+1;;/p-1.
What are the key properties of 4-(dimethylamino)-2-methylbenzenediazonium;zinc;chloride?
4-(dimethylamino)-2-methylbenzenediazonium;zinc;chloride has a molecular weight of 263.06 g/mol, XLogP of -0.45, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(dimethylamino)-2-methylbenzenediazonium;zinc;chloride is sourced from PubChem (CID 88518290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).