C10H14Cl3N3Zn — CID 173416980
zinc;4-(dimethylamino)-2,5-dimethylbenzenediazonium;trichloride (PubChem CID 173416980) has the molecular formula C10H14Cl3N3Zn and a molecular weight of 347.99 g/mol. Its IUPAC name is zinc;4-(dimethylamino)-2,5-dimethylbenzenediazonium;trichloride.
| Compound Name | zinc;4-(dimethylamino)-2,5-dimethylbenzenediazonium;trichloride |
|---|---|
| PubChem CID | 173416980 |
| Molecular Formula | C10H14Cl3N3Zn |
| Molecular Weight | 347.99 g/mol |
| Exact Mass | 344.95 |
| IUPAC Name | zinc;4-(dimethylamino)-2,5-dimethylbenzenediazonium;trichloride |
| SMILES | Cc1cc(N(C)C)c(C)cc1[N+]#N.[Cl-].[Cl-].[Cl-].[Zn+2] |
| InChI | InChI=1S/C10H14N3.3ClH.Zn/c1-7-6-10(13(3)4)8(2)5-9(7)12-11;;;;/h5-6H,1-4H3;3*1H;/q+1;;;;+2/p-3 |
| InChIKey | QMMLXBJGMGIGEP-UHFFFAOYSA-K |
| XLogP | -6.14 |
| TPSA | 31.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.99 |
| LogP ≤ 5 | -6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|