C8H9ClN2 — CID 12583461
2,5-dimethylbenzenediazonium chloride (PubChem CID 12583461) has the molecular formula C8H9ClN2 and a molecular weight of 168.63 g/mol. Its IUPAC name is 2,5-dimethylbenzenediazonium chloride.
| Compound Name | 2,5-dimethylbenzenediazonium chloride |
|---|---|
| PubChem CID | 12583461 |
| Molecular Formula | C8H9ClN2 |
| Molecular Weight | 168.63 g/mol |
| Exact Mass | 168.05 |
| IUPAC Name | 2,5-dimethylbenzenediazonium chloride |
| SMILES | Cc1ccc(C)c([N+]#N)c1.[Cl-] |
| InChI | InChI=1S/C8H9N2.ClH/c1-6-3-4-7(2)8(5-6)10-9;/h3-5H,1-2H3;1H/q+1;/p-1 |
| InChIKey | PYGMYTCTDCBZEI-UHFFFAOYSA-M |
| XLogP | -0.21 |
| TPSA | 28.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.63 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|