C9H11ClZn — CID 53471419
zinc;2-methanidyl-1,4-dimethylbenzene;chloride (PubChem CID 53471419) has the molecular formula C9H11ClZn and a molecular weight of 220.03 g/mol. Its IUPAC name is zinc;2-methanidyl-1,4-dimethylbenzene;chloride.
| Compound Name | zinc;2-methanidyl-1,4-dimethylbenzene;chloride |
|---|---|
| PubChem CID | 53471419 |
| Molecular Formula | C9H11ClZn |
| Molecular Weight | 220.03 g/mol |
| Exact Mass | 217.98 |
| IUPAC Name | zinc;2-methanidyl-1,4-dimethylbenzene;chloride |
| SMILES | [CH2-]c1cc(C)ccc1C.[Cl-].[Zn+2] |
| InChI | InChI=1S/C9H11.ClH.Zn/c1-7-4-5-8(2)9(3)6-7;;/h4-6H,3H2,1-2H3;1H;/q-1;;+2/p-1 |
| InChIKey | RPWOUKUSRSWDPQ-UHFFFAOYSA-M |
| XLogP | -0.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.03 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|