C22H30N4O11 — CID 88521134
N-[4-[3-[2,3-dihydroxy-3-[4-[2-hydroxyethyl(nitro)amino]phenyl]propoxy]-1,2-dihydroxypropyl]phenyl]-N-(2-hydroxyethyl)nitramide (PubChem CID 88521134) has the molecular formula C22H30N4O11 and a molecular weight of 526.50 g/mol. Its IUPAC name is N-[4-[3-[2,3-dihydroxy-3-[4-[2-hydroxyethyl(nitro)amino]phenyl]propoxy]-1,2-dihydroxypropyl]phenyl]-N-(2-hydroxyethyl)nitramide.
| Compound Name | N-[4-[3-[2,3-dihydroxy-3-[4-[2-hydroxyethyl(nitro)amino]phenyl]propoxy]-1,2-dihydroxypropyl]phenyl]-N-(2-hydroxyethyl)nitramide |
|---|---|
| PubChem CID | 88521134 |
| Molecular Formula | C22H30N4O11 |
| Molecular Weight | 526.50 g/mol |
| Exact Mass | 526.19 |
| IUPAC Name | N-[4-[3-[2,3-dihydroxy-3-[4-[2-hydroxyethyl(nitro)amino]phenyl]propoxy]-1,2-dihydroxypropyl]phenyl]-N-(2-hydroxyethyl)nitramide |
| SMILES | O=[N+]([O-])N(CCO)c1ccc(C(O)C(O)COCC(O)C(O)c2ccc(N(CCO)[N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C22H30N4O11/c27-11-9-23(25(33)34)17-5-1-15(2-6-17)21(31)19(29)13-37-14-20(30)22(32)16-3-7-18(8-4-16)24(10-12-28)26(35)36/h1-8,19-22,27-32H,9-14H2 |
| InChIKey | CWXWFFFGDJMGNJ-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 223.37 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.50 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|