C18H16N2O7S2 — CID 88531939
[(Z)-[(2Z)-2-(benzenesulfonyloxyimino)-3-oxocyclohexylidene]amino] benzenesulfonate (PubChem CID 88531939) has the molecular formula C18H16N2O7S2 and a molecular weight of 436.47 g/mol. Its IUPAC name is [(Z)-[(2Z)-2-(benzenesulfonyloxyimino)-3-oxocyclohexylidene]amino] benzenesulfonate.
| Compound Name | [(Z)-[(2Z)-2-(benzenesulfonyloxyimino)-3-oxocyclohexylidene]amino] benzenesulfonate |
|---|---|
| PubChem CID | 88531939 |
| Molecular Formula | C18H16N2O7S2 |
| Molecular Weight | 436.47 g/mol |
| Exact Mass | 436.04 |
| IUPAC Name | [(Z)-[(2Z)-2-(benzenesulfonyloxyimino)-3-oxocyclohexylidene]amino] benzenesulfonate |
| SMILES | O=C1CCCC(=N/OS(=O)(=O)c2ccccc2)/C1=N/OS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H16N2O7S2/c21-17-13-7-12-16(19-26-28(22,23)14-8-3-1-4-9-14)18(17)20-27-29(24,25)15-10-5-2-6-11-15/h1-6,8-11H,7,12-13H2/b19-16-,20-18- |
| InChIKey | XVHUHPKNKDIQJP-JYIQKWMYSA-N |
| XLogP | 2.26 |
| TPSA | 128.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.47 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|