C19H24ClN3O7 — CID 88532560
5-chloro-3-[2-[2-(N-methoxycarbonylanilino)propanoylamino]propanoylamino]-4-oxopentanoic acid (PubChem CID 88532560) has the molecular formula C19H24ClN3O7 and a molecular weight of 441.87 g/mol. Its IUPAC name is 5-chloro-3-[2-[2-(N-methoxycarbonylanilino)propanoylamino]propanoylamino]-4-oxopentanoic acid.
| Compound Name | 5-chloro-3-[2-[2-(N-methoxycarbonylanilino)propanoylamino]propanoylamino]-4-oxopentanoic acid |
|---|---|
| PubChem CID | 88532560 |
| Molecular Formula | C19H24ClN3O7 |
| Molecular Weight | 441.87 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | 5-chloro-3-[2-[2-(N-methoxycarbonylanilino)propanoylamino]propanoylamino]-4-oxopentanoic acid |
| SMILES | COC(=O)N(c1ccccc1)C(C)C(=O)NC(C)C(=O)NC(CC(=O)O)C(=O)CCl |
| InChI | InChI=1S/C19H24ClN3O7/c1-11(17(27)22-14(9-16(25)26)15(24)10-20)21-18(28)12(2)23(19(29)30-3)13-7-5-4-6-8-13/h4-8,11-12,14H,9-10H2,1-3H3,(H,21,28)(H,22,27)(H,25,26) |
| InChIKey | QNYUOHOXJAIQBQ-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 142.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.87 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|