C11H20ClNO5 — CID 88544375
2-[2-[1-[2-chloroethyl(methyl)amino]ethoxy]propanoyloxy]propanoic acid (PubChem CID 88544375) has the molecular formula C11H20ClNO5 and a molecular weight of 281.74 g/mol. Its IUPAC name is 2-[2-[1-[2-chloroethyl(methyl)amino]ethoxy]propanoyloxy]propanoic acid.
| Compound Name | 2-[2-[1-[2-chloroethyl(methyl)amino]ethoxy]propanoyloxy]propanoic acid |
|---|---|
| PubChem CID | 88544375 |
| Molecular Formula | C11H20ClNO5 |
| Molecular Weight | 281.74 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 2-[2-[1-[2-chloroethyl(methyl)amino]ethoxy]propanoyloxy]propanoic acid |
| SMILES | CC(OC(=O)C(C)OC(C)N(C)CCCl)C(=O)O |
| InChI | InChI=1S/C11H20ClNO5/c1-7(10(14)15)18-11(16)8(2)17-9(3)13(4)6-5-12/h7-9H,5-6H2,1-4H3,(H,14,15) |
| InChIKey | WBMRSAJQZGDQLR-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.74 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|