C32H41F6NOS — CID 88547159
6-(4-fluorophenyl)-5-[6-[4-(4,4,5,5,5-pentafluoropentylsulfanyl)butan-2-ylamino]hexyl]-8,9-dihydro-7H-benzo[7]annulen-2-ol (PubChem CID 88547159) has the molecular formula C32H41F6NOS and a molecular weight of 601.74 g/mol. Its IUPAC name is 6-(4-fluorophenyl)-5-[6-[4-(4,4,5,5,5-pentafluoropentylsulfanyl)butan-2-ylamino]hexyl]-8,9-dihydro-7H-benzo[7]annulen-2-ol.
| Compound Name | 6-(4-fluorophenyl)-5-[6-[4-(4,4,5,5,5-pentafluoropentylsulfanyl)butan-2-ylamino]hexyl]-8,9-dihydro-7H-benzo[7]annulen-2-ol |
|---|---|
| PubChem CID | 88547159 |
| Molecular Formula | C32H41F6NOS |
| Molecular Weight | 601.74 g/mol |
| Exact Mass | 601.28 |
| IUPAC Name | 6-(4-fluorophenyl)-5-[6-[4-(4,4,5,5,5-pentafluoropentylsulfanyl)butan-2-ylamino]hexyl]-8,9-dihydro-7H-benzo[7]annulen-2-ol |
| SMILES | CC(CCSCCCC(F)(F)C(F)(F)F)NCCCCCCC1=C(c2ccc(F)cc2)CCCc2cc(O)ccc21 |
| InChI | InChI=1S/C32H41F6NOS/c1-23(17-21-41-20-7-18-31(34,35)32(36,37)38)39-19-5-3-2-4-9-30-28(24-11-13-26(33)14-12-24)10-6-8-25-22-27(40)15-16-29(25)30/h11-16,22-23,39-40H,2-10,17-21H2,1H3 |
| InChIKey | CPMPXWNZZZCDOQ-UHFFFAOYSA-N |
| XLogP | 9.81 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.74 |
| LogP ≤ 5 | 9.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|