C8H8N2O3S2 — CID 88553341
1-(methoxymethyl)-3,5-bis(sulfinylamino)benzene (PubChem CID 88553341) has the molecular formula C8H8N2O3S2 and a molecular weight of 244.30 g/mol. Its IUPAC name is 1-(methoxymethyl)-3,5-bis(sulfinylamino)benzene.
| Compound Name | 1-(methoxymethyl)-3,5-bis(sulfinylamino)benzene |
|---|---|
| PubChem CID | 88553341 |
| Molecular Formula | C8H8N2O3S2 |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.00 |
| IUPAC Name | 1-(methoxymethyl)-3,5-bis(sulfinylamino)benzene |
| SMILES | COCc1cc(N=S=O)cc(N=S=O)c1 |
| InChI | InChI=1S/C8H8N2O3S2/c1-13-5-6-2-7(9-14-11)4-8(3-6)10-15-12/h2-4H,5H2,1H3 |
| InChIKey | GLDRHZOATNZUAE-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |