C18H23N6O15P3S2 — CID 88557403
[2-(2-amino-6-sulfanylidene-3H-purin-9-yl)-5-[[hydroxy-[hydroxy(phosphonooxy)phosphoryl]oxyphosphoryl]oxymethyl]-4-methoxyoxolan-3-yl] N-(2-acetylthiophen-3-yl)carbamate (PubChem CID 88557403) has the molecular formula C18H23N6O15P3S2 and a molecular weight of 720.46 g/mol. Its IUPAC name is [2-(2-amino-6-sulfanylidene-3H-purin-9-yl)-5-[[hydroxy-[hydroxy(phosphonooxy)phosphoryl]oxyphosphoryl]oxymethyl]-4-methoxyoxolan-3-yl] N-(2-acetylthiophen-3-yl)carbamate.
| Compound Name | [2-(2-amino-6-sulfanylidene-3H-purin-9-yl)-5-[[hydroxy-[hydroxy(phosphonooxy)phosphoryl]oxyphosphoryl]oxymethyl]-4-methoxyoxolan-3-yl] N-(2-acetylthiophen-3-yl)carbamate |
|---|---|
| PubChem CID | 88557403 |
| Molecular Formula | C18H23N6O15P3S2 |
| Molecular Weight | 720.46 g/mol |
| Exact Mass | 719.99 |
| IUPAC Name | [2-(2-amino-6-sulfanylidene-3H-purin-9-yl)-5-[[hydroxy-[hydroxy(phosphonooxy)phosphoryl]oxyphosphoryl]oxymethyl]-4-methoxyoxolan-3-yl] N-(2-acetylthiophen-3-yl)carbamate |
| SMILES | COC1C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)OC(n2cnc3c(=S)nc(N)[nH]c32)C1OC(=O)Nc1ccsc1C(C)=O |
| InChI | InChI=1S/C18H23N6O15P3S2/c1-7(25)13-8(3-4-44-13)21-18(26)37-12-11(34-2)9(5-35-41(30,31)39-42(32,33)38-40(27,28)29)36-16(12)24-6-20-10-14(24)22-17(19)23-15(10)43/h3-4,6,9,11-12,16H,5H2,1-2H3,(H,21,26)(H,30,31)(H,32,33)(H2,27,28,29)(H3,19,22,23,43) |
| InChIKey | BLWAZFFCCCZWCE-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 306.20 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.46 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|