C33H63NO2 — CID 88559466
N,N-dimethyl-3-[[(9Z,12Z)-octadeca-9,12-dienoxy]methyl]dodecanamide (PubChem CID 88559466) has the molecular formula C33H63NO2 and a molecular weight of 505.87 g/mol. Its IUPAC name is N,N-dimethyl-3-[[(9Z,12Z)-octadeca-9,12-dienoxy]methyl]dodecanamide.
| Compound Name | N,N-dimethyl-3-[[(9Z,12Z)-octadeca-9,12-dienoxy]methyl]dodecanamide |
|---|---|
| PubChem CID | 88559466 |
| Molecular Formula | C33H63NO2 |
| Molecular Weight | 505.87 g/mol |
| Exact Mass | 505.49 |
| IUPAC Name | N,N-dimethyl-3-[[(9Z,12Z)-octadeca-9,12-dienoxy]methyl]dodecanamide |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCOCC(CCCCCCCCC)CC(=O)N(C)C |
| InChI | InChI=1S/C33H63NO2/c1-5-7-9-11-13-14-15-16-17-18-19-20-21-23-25-27-29-36-31-32(30-33(35)34(3)4)28-26-24-22-12-10-8-6-2/h13-14,16-17,32H,5-12,15,18-31H2,1-4H3/b14-13-,17-16- |
| InChIKey | OXGGLDRSINPAFW-AUGURXLVSA-N |
| XLogP | 10.05 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.87 |
| LogP ≤ 5 | 10.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|