C5H14N2O6 — CID 88559979
1,5-bis[(dihydroxyamino)oxy]pentane (PubChem CID 88559979) has the molecular formula C5H14N2O6 and a molecular weight of 198.17 g/mol. Its IUPAC name is 1,5-bis[(dihydroxyamino)oxy]pentane.
| Compound Name | 1,5-bis[(dihydroxyamino)oxy]pentane |
|---|---|
| PubChem CID | 88559979 |
| Molecular Formula | C5H14N2O6 |
| Molecular Weight | 198.17 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 1,5-bis[(dihydroxyamino)oxy]pentane |
| SMILES | ON(O)OCCCCCON(O)O |
| InChI | InChI=1S/C5H14N2O6/c8-6(9)12-4-2-1-3-5-13-7(10)11/h8-11H,1-5H2 |
| InChIKey | QJTHERDEELJYNR-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 105.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.17 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|