11-(dihydroxyamino)oxyundecanoic acid

C11H23NO5 — CID 88938891

IUPAC11-(dihydroxyamino)oxyundecanoic acid
SMILESO=C(O)CCCCCCCCCCON(O)O
InChIInChI=1S/C11H23NO5/c13-11(14)9-7-5-3-1-2-4-6-8-10-17-12(15)16/h15-16H,1-10H2,(H,13,14)
InChIKeyYAOUOOBEFMFIMB-UHFFFAOYSA-N
MW249.31 g/mol
LogP2.59
Rot. Bonds12

About 11-(dihydroxyamino)oxyundecanoic acid

11-(dihydroxyamino)oxyundecanoic acid (PubChem CID 88938891) has the molecular formula C11H23NO5 and a molecular weight of 249.31 g/mol. Its IUPAC name is 11-(dihydroxyamino)oxyundecanoic acid.

Molecular Properties

Compound Name11-(dihydroxyamino)oxyundecanoic acid
PubChem CID88938891
Molecular FormulaC11H23NO5
Molecular Weight249.31 g/mol
Exact Mass249.16
IUPAC Name11-(dihydroxyamino)oxyundecanoic acid
SMILESO=C(O)CCCCCCCCCCON(O)O
InChIInChI=1S/C11H23NO5/c13-11(14)9-7-5-3-1-2-4-6-8-10-17-12(15)16/h15-16H,1-10H2,(H,13,14)
InChIKeyYAOUOOBEFMFIMB-UHFFFAOYSA-N
XLogP2.59
TPSA90.23 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds12
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500249.31
LogP ≤ 52.59
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 11-(dihydroxyamino)oxyundecanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

1,5-bis[(dihydroxyamino)oxy]pentane
CID 88559979
tridecanedioic acid;undecanedioic acid
CID 158333715
decanedioic acid;hexanedioic acid;octanedioic acid
CID 159110511
heptadecanedioic acid
CID 3083765
decanedioic acid;hexanedioic acid;nonanedioic acid;octanedioic acid
CID 159068248
tetradecanedioic acid
CID 13185
decanedioic acid;tris(nonanedioic acid)
CID 159759294
triacontanedioic acid
CID 5322010
dodecanedioic acid;bis(tridecanedioic acid)
CID 87373965
decanedioic acid;icosanedioic acid
CID 161217033
8-hydroperoxyoctanoic acid
CID 91550474
8-(3-carboxypropoxy)octanoic acid
CID 154155651

Frequently Asked Questions

What is the IUPAC name of 11-(dihydroxyamino)oxyundecanoic acid?
The IUPAC name of 11-(dihydroxyamino)oxyundecanoic acid (CID 88938891) is 11-(dihydroxyamino)oxyundecanoic acid.
What is the SMILES notation for 11-(dihydroxyamino)oxyundecanoic acid?
The canonical SMILES for 11-(dihydroxyamino)oxyundecanoic acid is O=C(O)CCCCCCCCCCON(O)O.
What is the InChIKey of 11-(dihydroxyamino)oxyundecanoic acid?
The InChIKey is YAOUOOBEFMFIMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23NO5/c13-11(14)9-7-5-3-1-2-4-6-8-10-17-12(15)16/h15-16H,1-10H2,(H,13,14).
What are the key properties of 11-(dihydroxyamino)oxyundecanoic acid?
11-(dihydroxyamino)oxyundecanoic acid has a molecular weight of 249.31 g/mol, XLogP of 2.59, 12 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 11-(dihydroxyamino)oxyundecanoic acid is sourced from PubChem (CID 88938891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).