C23H32N8O3 — CID 88565061
4-[(3E,5Z)-3-[(2-aminopyrimidin-4-yl)methoxy]hepta-1,3,5-trien-2-yl]-N-(5-tert-butyl-1,3,4-oxadiazol-2-yl)piperazine-1-carboxamide (PubChem CID 88565061) has the molecular formula C23H32N8O3 and a molecular weight of 468.56 g/mol. Its IUPAC name is 4-[(3E,5Z)-3-[(2-aminopyrimidin-4-yl)methoxy]hepta-1,3,5-trien-2-yl]-N-(5-tert-butyl-1,3,4-oxadiazol-2-yl)piperazine-1-carboxamide.
| Compound Name | 4-[(3E,5Z)-3-[(2-aminopyrimidin-4-yl)methoxy]hepta-1,3,5-trien-2-yl]-N-(5-tert-butyl-1,3,4-oxadiazol-2-yl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 88565061 |
| Molecular Formula | C23H32N8O3 |
| Molecular Weight | 468.56 g/mol |
| Exact Mass | 468.26 |
| IUPAC Name | 4-[(3E,5Z)-3-[(2-aminopyrimidin-4-yl)methoxy]hepta-1,3,5-trien-2-yl]-N-(5-tert-butyl-1,3,4-oxadiazol-2-yl)piperazine-1-carboxamide |
| SMILES | C=C(/C(=C\C=C/C)OCc1ccnc(N)n1)N1CCN(C(=O)Nc2nnc(C(C)(C)C)o2)CC1 |
| InChI | InChI=1S/C23H32N8O3/c1-6-7-8-18(33-15-17-9-10-25-20(24)26-17)16(2)30-11-13-31(14-12-30)22(32)27-21-29-28-19(34-21)23(3,4)5/h6-10H,2,11-15H2,1,3-5H3,(H2,24,25,26)(H,27,29,32)/b7-6-,18-8+ |
| InChIKey | IJNWUXNZKHWYMH-FWNKGETMSA-N |
| XLogP | 3.08 |
| TPSA | 135.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.56 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|