C24H26N2O2 — CID 88565842
N-cyclopropyl-4-methyl-3-[[(2E,4E)-2-methyl-4-phenylhexa-2,4-dienoyl]amino]benzamide (PubChem CID 88565842) has the molecular formula C24H26N2O2 and a molecular weight of 374.48 g/mol. Its IUPAC name is N-cyclopropyl-4-methyl-3-[[(2E,4E)-2-methyl-4-phenylhexa-2,4-dienoyl]amino]benzamide.
| Compound Name | N-cyclopropyl-4-methyl-3-[[(2E,4E)-2-methyl-4-phenylhexa-2,4-dienoyl]amino]benzamide |
|---|---|
| PubChem CID | 88565842 |
| Molecular Formula | C24H26N2O2 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | N-cyclopropyl-4-methyl-3-[[(2E,4E)-2-methyl-4-phenylhexa-2,4-dienoyl]amino]benzamide |
| SMILES | C/C=C(\C=C(/C)C(=O)Nc1cc(C(=O)NC2CC2)ccc1C)c1ccccc1 |
| InChI | InChI=1S/C24H26N2O2/c1-4-18(19-8-6-5-7-9-19)14-17(3)23(27)26-22-15-20(11-10-16(22)2)24(28)25-21-12-13-21/h4-11,14-15,21H,12-13H2,1-3H3,(H,25,28)(H,26,27)/b17-14+,18-4+ |
| InChIKey | GGCZIKZYPXAWQK-ROHWBCOBSA-N |
| XLogP | 4.88 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|