C17H14BCl2F3N2 — CID 88576932
CID 88576932 (PubChem CID 88576932) has the molecular formula C17H14BCl2F3N2 and a molecular weight of 385.03 g/mol.
| Compound Name | CID 88576932 |
|---|---|
| PubChem CID | 88576932 |
| Molecular Formula | C17H14BCl2F3N2 |
| Molecular Weight | 385.03 g/mol |
| Exact Mass | 384.06 |
| IUPAC Name | — |
| SMILES | [B]c1cc(N2CCC(c3cc(Cl)cc(Cl)c3)(C(F)(F)F)C2)ccc1N |
| InChI | InChI=1S/C17H14BCl2F3N2/c18-14-8-13(1-2-15(14)24)25-4-3-16(9-25,17(21,22)23)10-5-11(19)7-12(20)6-10/h1-2,5-8H,3-4,9,24H2 |
| InChIKey | FJXRSKACFQODLL-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.03 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|