C58H106N2O8 — CID 88586184
N-[5-[2-[2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxolan-4-yl]ethyl-methylamino]pentyl]-5-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxypentanamide (PubChem CID 88586184) has the molecular formula C58H106N2O8 and a molecular weight of 959.49 g/mol. Its IUPAC name is N-[5-[2-[2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxolan-4-yl]ethyl-methylamino]pentyl]-5-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxypentanamide.
| Compound Name | N-[5-[2-[2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxolan-4-yl]ethyl-methylamino]pentyl]-5-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxypentanamide |
|---|---|
| PubChem CID | 88586184 |
| Molecular Formula | C58H106N2O8 |
| Molecular Weight | 959.49 g/mol |
| Exact Mass | 958.79 |
| IUPAC Name | N-[5-[2-[2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxolan-4-yl]ethyl-methylamino]pentyl]-5-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxypentanamide |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC1(CCCCCCCC/C=C\C/C=C\CCCCC)OCC(CCN(C)CCCCCNC(=O)CCCCOC2OC(C)C(O)C(O)C2O)O1 |
| InChI | InChI=1S/C58H106N2O8/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-37-44-58(45-38-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2)66-50-52(68-58)43-48-60(4)47-40-35-39-46-59-53(61)42-36-41-49-65-57-56(64)55(63)54(62)51(3)67-57/h13-16,19-22,51-52,54-57,62-64H,5-12,17-18,23-50H2,1-4H3,(H,59,61)/b15-13-,16-14-,21-19-,22-20- |
| InChIKey | SBZXHUDWZSUHBB-KWXKLSQISA-N |
| XLogP | 13.13 |
| TPSA | 129.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 45 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 959.49 |
| LogP ≤ 5 | 13.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|