About CID 88586830
CID 88586830 (PubChem CID 88586830) has the molecular formula C7H5BO3
and a molecular weight of 147.93 g/mol.
Molecular Properties
| Compound Name | CID 88586830 |
| PubChem CID | 88586830 |
| Molecular Formula | C7H5BO3 |
| Molecular Weight | 147.93 g/mol |
| Exact Mass | 148.03 |
| IUPAC Name | — |
| SMILES | [B]c1cc(O)c(O)cc1C=O |
| InChI | InChI=1S/C7H5BO3/c8-5-2-7(11)6(10)1-4(5)3-9/h1-3,10-11H |
| InChIKey | RJEVSVFUSOVVTG-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.93 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 88586830 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 88586830?
The IUPAC name of CID 88586830 (CID 88586830) is not available.
What is the SMILES notation for CID 88586830?
The canonical SMILES for CID 88586830 is [B]c1cc(O)c(O)cc1C=O.
What is the InChIKey of CID 88586830?
The InChIKey is RJEVSVFUSOVVTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5BO3/c8-5-2-7(11)6(10)1-4(5)3-9/h1-3,10-11H.
What are the key properties of CID 88586830?
CID 88586830 has a molecular weight of 147.93 g/mol, XLogP of -0.30, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 88586830 is sourced from PubChem (CID 88586830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).