C14H19ClFN3O3 — CID 88589847
ethyl 2-[(1R)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-1-hydroxycyclohexyl]acetate (PubChem CID 88589847) has the molecular formula C14H19ClFN3O3 and a molecular weight of 331.78 g/mol. Its IUPAC name is ethyl 2-[(1R)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-1-hydroxycyclohexyl]acetate.
| Compound Name | ethyl 2-[(1R)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-1-hydroxycyclohexyl]acetate |
|---|---|
| PubChem CID | 88589847 |
| Molecular Formula | C14H19ClFN3O3 |
| Molecular Weight | 331.78 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | ethyl 2-[(1R)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-1-hydroxycyclohexyl]acetate |
| SMILES | CCOC(=O)C[C@@]1(O)CCCC(Nc2nc(Cl)ncc2F)C1 |
| InChI | InChI=1S/C14H19ClFN3O3/c1-2-22-11(20)7-14(21)5-3-4-9(6-14)18-12-10(16)8-17-13(15)19-12/h8-9,21H,2-7H2,1H3,(H,17,18,19)/t9?,14-/m1/s1 |
| InChIKey | IQBDXSNXWWFCRV-IWSPRGBSSA-N |
| XLogP | 2.31 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.78 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |