C9H14O — CID 88590180
(3S,5R)-5-methyloct-1-en-6-yn-3-ol (PubChem CID 88590180) has the molecular formula C9H14O and a molecular weight of 138.21 g/mol. Its IUPAC name is (3S,5R)-5-methyloct-1-en-6-yn-3-ol.
| Compound Name | (3S,5R)-5-methyloct-1-en-6-yn-3-ol |
|---|---|
| PubChem CID | 88590180 |
| Molecular Formula | C9H14O |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.10 |
| IUPAC Name | (3S,5R)-5-methyloct-1-en-6-yn-3-ol |
| SMILES | C=C[C@@H](O)C[C@@H](C)C#CC |
| InChI | InChI=1S/C9H14O/c1-4-6-8(3)7-9(10)5-2/h5,8-10H,2,7H2,1,3H3/t8-,9+/m0/s1 |
| InChIKey | SEZBKBKBXWNBNS-DTWKUNHWSA-N |
| XLogP | 1.58 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|