C23H18O9 — CID 88590547
[5,7-dihydroxy-2-(4-methoxyphenyl)-4H-chromen-3-yl] 3,4,5-trihydroxybenzoate (PubChem CID 88590547) has the molecular formula C23H18O9 and a molecular weight of 438.39 g/mol. Its IUPAC name is [5,7-dihydroxy-2-(4-methoxyphenyl)-4H-chromen-3-yl] 3,4,5-trihydroxybenzoate.
| Compound Name | [5,7-dihydroxy-2-(4-methoxyphenyl)-4H-chromen-3-yl] 3,4,5-trihydroxybenzoate |
|---|---|
| PubChem CID | 88590547 |
| Molecular Formula | C23H18O9 |
| Molecular Weight | 438.39 g/mol |
| Exact Mass | 438.10 |
| IUPAC Name | [5,7-dihydroxy-2-(4-methoxyphenyl)-4H-chromen-3-yl] 3,4,5-trihydroxybenzoate |
| SMILES | COc1ccc(C2=C(OC(=O)c3cc(O)c(O)c(O)c3)Cc3c(O)cc(O)cc3O2)cc1 |
| InChI | InChI=1S/C23H18O9/c1-30-14-4-2-11(3-5-14)22-20(10-15-16(25)8-13(24)9-19(15)31-22)32-23(29)12-6-17(26)21(28)18(27)7-12/h2-9,24-28H,10H2,1H3 |
| InChIKey | ZPZNFRORVLQQCS-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 145.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.39 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|