C10H16O9Si — CID 88601705
3-[(2-carboxyacetyl)oxy-trimethylsilyloxymethoxy]-3-oxopropanoic acid (PubChem CID 88601705) has the molecular formula C10H16O9Si and a molecular weight of 308.32 g/mol. Its IUPAC name is 3-[(2-carboxyacetyl)oxy-trimethylsilyloxymethoxy]-3-oxopropanoic acid.
| Compound Name | 3-[(2-carboxyacetyl)oxy-trimethylsilyloxymethoxy]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 88601705 |
| Molecular Formula | C10H16O9Si |
| Molecular Weight | 308.32 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | 3-[(2-carboxyacetyl)oxy-trimethylsilyloxymethoxy]-3-oxopropanoic acid |
| SMILES | C[Si](C)(C)OC(OC(=O)CC(=O)O)OC(=O)CC(=O)O |
| InChI | InChI=1S/C10H16O9Si/c1-20(2,3)19-10(17-8(15)4-6(11)12)18-9(16)5-7(13)14/h10H,4-5H2,1-3H3,(H,11,12)(H,13,14) |
| InChIKey | CGXVEUKGZABBIM-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 136.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.32 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|