C13H20O10 — CID 88674896
3-[acetyloxy-(2-carboxyacetyl)oxymethoxy]-3-oxopropanoic acid;butane (PubChem CID 88674896) has the molecular formula C13H20O10 and a molecular weight of 336.29 g/mol. Its IUPAC name is 3-[acetyloxy-(2-carboxyacetyl)oxymethoxy]-3-oxopropanoic acid;butane.
| Compound Name | 3-[acetyloxy-(2-carboxyacetyl)oxymethoxy]-3-oxopropanoic acid;butane |
|---|---|
| PubChem CID | 88674896 |
| Molecular Formula | C13H20O10 |
| Molecular Weight | 336.29 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 3-[acetyloxy-(2-carboxyacetyl)oxymethoxy]-3-oxopropanoic acid;butane |
| SMILES | CC(=O)OC(OC(=O)CC(=O)O)OC(=O)CC(=O)O.CCCC |
| InChI | InChI=1S/C9H10O10.C4H10/c1-4(10)17-9(18-7(15)2-5(11)12)19-8(16)3-6(13)14;1-3-4-2/h9H,2-3H2,1H3,(H,11,12)(H,13,14);3-4H2,1-2H3 |
| InChIKey | VMTUKIMJGJDBRV-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 153.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.29 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|