C17H12O2 — CID 88605109
5,5-diphenylpenta-2,3,4-trienoic acid (PubChem CID 88605109) has the molecular formula C17H12O2 and a molecular weight of 248.28 g/mol. Its IUPAC name is 5,5-diphenylpenta-2,3,4-trienoic acid.
| Compound Name | 5,5-diphenylpenta-2,3,4-trienoic acid |
|---|---|
| PubChem CID | 88605109 |
| Molecular Formula | C17H12O2 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 5,5-diphenylpenta-2,3,4-trienoic acid |
| SMILES | O=C(O)C=C=C=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H12O2/c18-17(19)13-7-12-16(14-8-3-1-4-9-14)15-10-5-2-6-11-15/h1-6,8-11,13H,(H,18,19) |
| InChIKey | PWKKMRCAIFPFDA-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|