C18H21ClN4O3S — CID 8860572
N-[(Z)-1-(5-chloro-2-methoxyphenyl)ethylideneamino]-4-methyl-2-morpholin-4-yl-1,3-thiazole-5-carboxamide (PubChem CID 8860572) has the molecular formula C18H21ClN4O3S and a molecular weight of 408.91 g/mol. Its IUPAC name is N-[(Z)-1-(5-chloro-2-methoxyphenyl)ethylideneamino]-4-methyl-2-morpholin-4-yl-1,3-thiazole-5-carboxamide.
| Compound Name | N-[(Z)-1-(5-chloro-2-methoxyphenyl)ethylideneamino]-4-methyl-2-morpholin-4-yl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 8860572 |
| Molecular Formula | C18H21ClN4O3S |
| Molecular Weight | 408.91 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | N-[(Z)-1-(5-chloro-2-methoxyphenyl)ethylideneamino]-4-methyl-2-morpholin-4-yl-1,3-thiazole-5-carboxamide |
| SMILES | COc1ccc(Cl)cc1/C(C)=N\NC(=O)c1sc(N2CCOCC2)nc1C |
| InChI | InChI=1S/C18H21ClN4O3S/c1-11(14-10-13(19)4-5-15(14)25-3)21-22-17(24)16-12(2)20-18(27-16)23-6-8-26-9-7-23/h4-5,10H,6-9H2,1-3H3,(H,22,24)/b21-11- |
| InChIKey | MJTDNBFZALLZJS-NHDPSOOVSA-N |
| XLogP | 3.10 |
| TPSA | 76.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.91 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|