C13H12N4O5 — CID 88610655
(4,4-diamino-3-nitrocyclohexa-2,5-dien-1-yl)-(3-nitrophenyl)methanone (PubChem CID 88610655) has the molecular formula C13H12N4O5 and a molecular weight of 304.26 g/mol. Its IUPAC name is (4,4-diamino-3-nitrocyclohexa-2,5-dien-1-yl)-(3-nitrophenyl)methanone.
| Compound Name | (4,4-diamino-3-nitrocyclohexa-2,5-dien-1-yl)-(3-nitrophenyl)methanone |
|---|---|
| PubChem CID | 88610655 |
| Molecular Formula | C13H12N4O5 |
| Molecular Weight | 304.26 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | (4,4-diamino-3-nitrocyclohexa-2,5-dien-1-yl)-(3-nitrophenyl)methanone |
| SMILES | NC1(N)C=CC(C(=O)c2cccc([N+](=O)[O-])c2)C=C1[N+](=O)[O-] |
| InChI | InChI=1S/C13H12N4O5/c14-13(15)5-4-9(7-11(13)17(21)22)12(18)8-2-1-3-10(6-8)16(19)20/h1-7,9H,14-15H2 |
| InChIKey | SPCGNXAGLSLQNC-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 155.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.26 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|