C10H18O3 — CID 88611425
2-[2-(prop-2-enoxymethyl)prop-2-enyl]propane-1,3-diol (PubChem CID 88611425) has the molecular formula C10H18O3 and a molecular weight of 186.25 g/mol. Its IUPAC name is 2-[2-(prop-2-enoxymethyl)prop-2-enyl]propane-1,3-diol.
| Compound Name | 2-[2-(prop-2-enoxymethyl)prop-2-enyl]propane-1,3-diol |
|---|---|
| PubChem CID | 88611425 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | 2-[2-(prop-2-enoxymethyl)prop-2-enyl]propane-1,3-diol |
| SMILES | C=CCOCC(=C)CC(CO)CO |
| InChI | InChI=1S/C10H18O3/c1-3-4-13-8-9(2)5-10(6-11)7-12/h3,10-12H,1-2,4-8H2 |
| InChIKey | IEFMJWJGKNOSCE-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|