About hydroxy-[(1S,2S)-2-hydroxy-1-naphthalen-1-ylsulfonyloxypropoxy]-oxophosphanium
hydroxy-[(1S,2S)-2-hydroxy-1-naphthalen-1-ylsulfonyloxypropoxy]-oxophosphanium (PubChem CID 88613899) has the molecular formula C13H14O7PS+
and a molecular weight of 345.29 g/mol. Its IUPAC name is hydroxy-[(1S,2S)-2-hydroxy-1-naphthalen-1-ylsulfonyloxypropoxy]-oxophosphanium.
Molecular Properties
| Compound Name | hydroxy-[(1S,2S)-2-hydroxy-1-naphthalen-1-ylsulfonyloxypropoxy]-oxophosphanium |
| PubChem CID | 88613899 |
| Molecular Formula | C13H14O7PS+ |
| Molecular Weight | 345.29 g/mol |
| Exact Mass | 345.02 |
| IUPAC Name | hydroxy-[(1S,2S)-2-hydroxy-1-naphthalen-1-ylsulfonyloxypropoxy]-oxophosphanium |
| SMILES | C[C@H](O)[C@@H](O[P+](=O)O)OS(=O)(=O)c1cccc2ccccc12 |
| InChI | InChI=1S/C13H13O7PS/c1-9(14)13(19-21(15)16)20-22(17,18)12-8-4-6-10-5-2-3-7-11(10)12/h2-9,13-14H,1H3/p+1/t9-,13-/m0/s1 |
| InChIKey | NQPYYQOOFRGKBX-ZANVPECISA-O |
| XLogP | 1.92 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.29 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze hydroxy-[(1S,2S)-2-hydroxy-1-naphthalen-1-ylsulfonyloxypropoxy]-oxophosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydroxy-[(1S,2S)-2-hydroxy-1-naphthalen-1-ylsulfonyloxypropoxy]-oxophosphanium?
The IUPAC name of hydroxy-[(1S,2S)-2-hydroxy-1-naphthalen-1-ylsulfonyloxypropoxy]-oxophosphanium (CID 88613899) is hydroxy-[(1S,2S)-2-hydroxy-1-naphthalen-1-ylsulfonyloxypropoxy]-oxophosphanium.
What is the SMILES notation for hydroxy-[(1S,2S)-2-hydroxy-1-naphthalen-1-ylsulfonyloxypropoxy]-oxophosphanium?
The canonical SMILES for hydroxy-[(1S,2S)-2-hydroxy-1-naphthalen-1-ylsulfonyloxypropoxy]-oxophosphanium is C[C@H](O)[C@@H](O[P+](=O)O)OS(=O)(=O)c1cccc2ccccc12.
What is the InChIKey of hydroxy-[(1S,2S)-2-hydroxy-1-naphthalen-1-ylsulfonyloxypropoxy]-oxophosphanium?
The InChIKey is NQPYYQOOFRGKBX-ZANVPECISA-O. The full InChI is InChI=1S/C13H13O7PS/c1-9(14)13(19-21(15)16)20-22(17,18)12-8-4-6-10-5-2-3-7-11(10)12/h2-9,13-14H,1H3/p+1/t9-,13-/m0/s1.
What are the key properties of hydroxy-[(1S,2S)-2-hydroxy-1-naphthalen-1-ylsulfonyloxypropoxy]-oxophosphanium?
hydroxy-[(1S,2S)-2-hydroxy-1-naphthalen-1-ylsulfonyloxypropoxy]-oxophosphanium has a molecular weight of 345.29 g/mol, XLogP of 1.92, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for hydroxy-[(1S,2S)-2-hydroxy-1-naphthalen-1-ylsulfonyloxypropoxy]-oxophosphanium is sourced from PubChem (CID 88613899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).